C26H28N4O3 — CID 58347672
N-methyl-4-phenylmethoxy-N-[1-(2-pyrazin-2-ylacetyl)piperidin-4-yl]benzamide (PubChem CID 58347672) has the molecular formula C26H28N4O3 and a molecular weight of 444.54 g/mol. Its IUPAC name is N-methyl-4-phenylmethoxy-N-[1-(2-pyrazin-2-ylacetyl)piperidin-4-yl]benzamide.
| Compound Name | N-methyl-4-phenylmethoxy-N-[1-(2-pyrazin-2-ylacetyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 58347672 |
| Molecular Formula | C26H28N4O3 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | N-methyl-4-phenylmethoxy-N-[1-(2-pyrazin-2-ylacetyl)piperidin-4-yl]benzamide |
| SMILES | CN(C(=O)c1ccc(OCc2ccccc2)cc1)C1CCN(C(=O)Cc2cnccn2)CC1 |
| InChI | InChI=1S/C26H28N4O3/c1-29(23-11-15-30(16-12-23)25(31)17-22-18-27-13-14-28-22)26(32)21-7-9-24(10-8-21)33-19-20-5-3-2-4-6-20/h2-10,13-14,18,23H,11-12,15-17,19H2,1H3 |
| InChIKey | TUCMRHBRFQHWNA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |