C27H26N4O5 — CID 138703316
ethyl 2-[5-[5-(3-cyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-2-oxo-3,3a,4,8b-tetrahydroindeno[1,2-b]pyrrol-1-yl]acetate (PubChem CID 138703316) has the molecular formula C27H26N4O5 and a molecular weight of 486.53 g/mol. Its IUPAC name is ethyl 2-[5-[5-(3-cyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-2-oxo-3,3a,4,8b-tetrahydroindeno[1,2-b]pyrrol-1-yl]acetate.
| Compound Name | ethyl 2-[5-[5-(3-cyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-2-oxo-3,3a,4,8b-tetrahydroindeno[1,2-b]pyrrol-1-yl]acetate |
|---|---|
| PubChem CID | 138703316 |
| Molecular Formula | C27H26N4O5 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | ethyl 2-[5-[5-(3-cyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-2-oxo-3,3a,4,8b-tetrahydroindeno[1,2-b]pyrrol-1-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)CC2Cc3c(-c4noc(-c5ccc(OC(C)C)c(C#N)c5)n4)cccc3C21 |
| InChI | InChI=1S/C27H26N4O5/c1-4-34-24(33)14-31-23(32)12-17-11-21-19(25(17)31)6-5-7-20(21)26-29-27(36-30-26)16-8-9-22(35-15(2)3)18(10-16)13-28/h5-10,15,17,25H,4,11-12,14H2,1-3H3 |
| InChIKey | RQQGTLCXUNPYEX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 118.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |