C26H24N4O5 — CID 145445673
3-[(3aR,8bS)-5-[5-(3-cyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-2-oxo-3,3a,4,8b-tetrahydroindeno[1,2-b]pyrrol-1-yl]propanoic acid (PubChem CID 145445673) has the molecular formula C26H24N4O5 and a molecular weight of 472.50 g/mol. Its IUPAC name is 3-[(3aR,8bS)-5-[5-(3-cyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-2-oxo-3,3a,4,8b-tetrahydroindeno[1,2-b]pyrrol-1-yl]propanoic acid.
| Compound Name | 3-[(3aR,8bS)-5-[5-(3-cyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-2-oxo-3,3a,4,8b-tetrahydroindeno[1,2-b]pyrrol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 145445673 |
| Molecular Formula | C26H24N4O5 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | 3-[(3aR,8bS)-5-[5-(3-cyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-2-oxo-3,3a,4,8b-tetrahydroindeno[1,2-b]pyrrol-1-yl]propanoic acid |
| SMILES | CC(C)Oc1ccc(-c2nc(-c3cccc4c3C[C@@H]3CC(=O)N(CCC(=O)O)[C@H]43)no2)cc1C#N |
| InChI | InChI=1S/C26H24N4O5/c1-14(2)34-21-7-6-15(10-17(21)13-27)26-28-25(29-35-26)19-5-3-4-18-20(19)11-16-12-22(31)30(24(16)18)9-8-23(32)33/h3-7,10,14,16,24H,8-9,11-12H2,1-2H3,(H,32,33)/t16-,24+/m1/s1 |
| InChIKey | HTDRTIUELNXEHR-GYCJOSAFSA-N |
| XLogP | 3.98 |
| TPSA | 129.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |