C12H23NO — CID 138703319
(3E,5Z)-N-(2-ethoxyethyl)-3-methylhepta-3,5-dien-2-amine (PubChem CID 138703319) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is (3E,5Z)-N-(2-ethoxyethyl)-3-methylhepta-3,5-dien-2-amine.
| Compound Name | (3E,5Z)-N-(2-ethoxyethyl)-3-methylhepta-3,5-dien-2-amine |
|---|---|
| PubChem CID | 138703319 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | (3E,5Z)-N-(2-ethoxyethyl)-3-methylhepta-3,5-dien-2-amine |
| SMILES | C/C=C\C=C(/C)C(C)NCCOCC |
| InChI | InChI=1S/C12H23NO/c1-5-7-8-11(3)12(4)13-9-10-14-6-2/h5,7-8,12-13H,6,9-10H2,1-4H3/b7-5-,11-8+ |
| InChIKey | BWYMACLWFQMKQA-UKJSTWFMSA-N |
| XLogP | 2.52 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|