C12H20FNO — CID 144147423
(3E,5E)-3-ethenyl-6-fluoro-N-(2-methoxyethyl)hepta-3,5-dien-2-amine (PubChem CID 144147423) has the molecular formula C12H20FNO and a molecular weight of 213.29 g/mol. Its IUPAC name is (3E,5E)-3-ethenyl-6-fluoro-N-(2-methoxyethyl)hepta-3,5-dien-2-amine.
| Compound Name | (3E,5E)-3-ethenyl-6-fluoro-N-(2-methoxyethyl)hepta-3,5-dien-2-amine |
|---|---|
| PubChem CID | 144147423 |
| Molecular Formula | C12H20FNO |
| Molecular Weight | 213.29 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | (3E,5E)-3-ethenyl-6-fluoro-N-(2-methoxyethyl)hepta-3,5-dien-2-amine |
| SMILES | CC(/C(=C/C=C(\C)/F)/C=C)NCCOC |
| InChI | InChI=1S/C12H20FNO/c1-5-12(7-6-10(2)13)11(3)14-8-9-15-4/h5-7,11,14H,1,8-9H2,2-4H3/b10-6+,12-7+ |
| InChIKey | WOEOBLSLQJUOCY-QXZILWSFSA-N |
| XLogP | 2.50 |
| TPSA | 21.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | 246 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|