C26H48N4 — CID 138706096
4-N-[(3Z)-hexa-1,3,5-trien-2-yl]-4-N,3,3,4-tetramethyl-1-N-(methylaminomethyl)-1-N-[3-methyl-4-(propan-2-ylamino)penta-1,4-dien-2-yl]pentane-1,4-diamine (PubChem CID 138706096) has the molecular formula C26H48N4 and a molecular weight of 416.70 g/mol. Its IUPAC name is 4-N-[(3Z)-hexa-1,3,5-trien-2-yl]-4-N,3,3,4-tetramethyl-1-N-(methylaminomethyl)-1-N-[3-methyl-4-(propan-2-ylamino)penta-1,4-dien-2-yl]pentane-1,4-diamine.
| Compound Name | 4-N-[(3Z)-hexa-1,3,5-trien-2-yl]-4-N,3,3,4-tetramethyl-1-N-(methylaminomethyl)-1-N-[3-methyl-4-(propan-2-ylamino)penta-1,4-dien-2-yl]pentane-1,4-diamine |
|---|---|
| PubChem CID | 138706096 |
| Molecular Formula | C26H48N4 |
| Molecular Weight | 416.70 g/mol |
| Exact Mass | 416.39 |
| IUPAC Name | 4-N-[(3Z)-hexa-1,3,5-trien-2-yl]-4-N,3,3,4-tetramethyl-1-N-(methylaminomethyl)-1-N-[3-methyl-4-(propan-2-ylamino)penta-1,4-dien-2-yl]pentane-1,4-diamine |
| SMILES | C=C/C=C\C(=C)N(C)C(C)(C)C(C)(C)CCN(CNC)C(=C)C(C)C(=C)NC(C)C |
| InChI | InChI=1S/C26H48N4/c1-14-15-16-21(4)29(13)26(10,11)25(8,9)17-18-30(19-27-12)24(7)22(5)23(6)28-20(2)3/h14-16,20,22,27-28H,1,4,6-7,17-19H2,2-3,5,8-13H3/b16-15- |
| InChIKey | GKPOIUMVIARWBN-NXVVXOECSA-N |
| XLogP | 5.51 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.70 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|