C28H52O4 — CID 138708222
bis(3-ethyloctan-3-yl) cyclohexane-1,3-dicarboxylate (PubChem CID 138708222) has the molecular formula C28H52O4 and a molecular weight of 452.72 g/mol. Its IUPAC name is bis(3-ethyloctan-3-yl) cyclohexane-1,3-dicarboxylate.
| Compound Name | bis(3-ethyloctan-3-yl) cyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 138708222 |
| Molecular Formula | C28H52O4 |
| Molecular Weight | 452.72 g/mol |
| Exact Mass | 452.39 |
| IUPAC Name | bis(3-ethyloctan-3-yl) cyclohexane-1,3-dicarboxylate |
| SMILES | CCCCCC(CC)(CC)OC(=O)C1CCCC(C(=O)OC(CC)(CC)CCCCC)C1 |
| InChI | InChI=1S/C28H52O4/c1-7-13-15-20-27(9-3,10-4)31-25(29)23-18-17-19-24(22-23)26(30)32-28(11-5,12-6)21-16-14-8-2/h23-24H,7-22H2,1-6H3 |
| InChIKey | NRBGYKKBFMFBFH-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.72 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|