C21H36O4 — CID 70926218
3-(3-ethyloctan-3-yloxycarbonyl)-7,7-dimethylbicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 70926218) has the molecular formula C21H36O4 and a molecular weight of 352.52 g/mol. Its IUPAC name is 3-(3-ethyloctan-3-yloxycarbonyl)-7,7-dimethylbicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | 3-(3-ethyloctan-3-yloxycarbonyl)-7,7-dimethylbicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 70926218 |
| Molecular Formula | C21H36O4 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.26 |
| IUPAC Name | 3-(3-ethyloctan-3-yloxycarbonyl)-7,7-dimethylbicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | CCCCCC(CC)(CC)OC(=O)C1C(C(=O)O)C2CCC1C2(C)C |
| InChI | InChI=1S/C21H36O4/c1-6-9-10-13-21(7-2,8-3)25-19(24)17-15-12-11-14(20(15,4)5)16(17)18(22)23/h14-17H,6-13H2,1-5H3,(H,22,23) |
| InChIKey | ROEXRPJVHLLYIB-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|