C23H20FNOS — CID 138712139
2-[6-butyl-4-(4-fluorophenyl)-1,3-benzothiazol-2-yl]phenol (PubChem CID 138712139) has the molecular formula C23H20FNOS and a molecular weight of 377.48 g/mol. Its IUPAC name is 2-[6-butyl-4-(4-fluorophenyl)-1,3-benzothiazol-2-yl]phenol.
| Compound Name | 2-[6-butyl-4-(4-fluorophenyl)-1,3-benzothiazol-2-yl]phenol |
|---|---|
| PubChem CID | 138712139 |
| Molecular Formula | C23H20FNOS |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 2-[6-butyl-4-(4-fluorophenyl)-1,3-benzothiazol-2-yl]phenol |
| SMILES | CCCCc1cc(-c2ccc(F)cc2)c2nc(-c3ccccc3O)sc2c1 |
| InChI | InChI=1S/C23H20FNOS/c1-2-3-6-15-13-19(16-9-11-17(24)12-10-16)22-21(14-15)27-23(25-22)18-7-4-5-8-20(18)26/h4-5,7-14,26H,2-3,6H2,1H3 |
| InChIKey | HQXQEYBEBWXOAU-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |