C34H47N5O9 — CID 138713370
(2S)-2-[[(1S)-1-carboxy-5-[[(2S)-2-[[4-(ethylaminomethyl)cyclohexanecarbonyl]amino]-2-naphthalen-2-ylacetyl]amino]pentyl]carbamoylamino]pentanedioic acid (PubChem CID 138713370) has the molecular formula C34H47N5O9 and a molecular weight of 669.78 g/mol. Its IUPAC name is (2S)-2-[[(1S)-1-carboxy-5-[[(2S)-2-[[4-(ethylaminomethyl)cyclohexanecarbonyl]amino]-2-naphthalen-2-ylacetyl]amino]pentyl]carbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[(1S)-1-carboxy-5-[[(2S)-2-[[4-(ethylaminomethyl)cyclohexanecarbonyl]amino]-2-naphthalen-2-ylacetyl]amino]pentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 138713370 |
| Molecular Formula | C34H47N5O9 |
| Molecular Weight | 669.78 g/mol |
| Exact Mass | 669.34 |
| IUPAC Name | (2S)-2-[[(1S)-1-carboxy-5-[[(2S)-2-[[4-(ethylaminomethyl)cyclohexanecarbonyl]amino]-2-naphthalen-2-ylacetyl]amino]pentyl]carbamoylamino]pentanedioic acid |
| SMILES | CCNCC1CCC(C(=O)N[C@H](C(=O)NCCCC[C@H](NC(=O)N[C@@H](CCC(=O)O)C(=O)O)C(=O)O)c2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C34H47N5O9/c1-2-35-20-21-10-12-23(13-11-21)30(42)39-29(25-15-14-22-7-3-4-8-24(22)19-25)31(43)36-18-6-5-9-26(32(44)45)37-34(48)38-27(33(46)47)16-17-28(40)41/h3-4,7-8,14-15,19,21,23,26-27,29,35H,2,5-6,9-13,16-18,20H2,1H3,(H,36,43)(H,39,42)(H,40,41)(H,44,45)(H,46,47)(H2,37,38,48)/t21?,23?,26-,27-,29-/m0/s1 |
| InChIKey | HIWYBCJIVQLWBC-QLSCWIHLSA-N |
| XLogP | 2.77 |
| TPSA | 223.26 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.78 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|