C25H20O6 — CID 138714421
[2-(2-acetyloxy-1,3-dioxo-5,6-dihydroinden-2-yl)-5-phenylphenyl] acetate (PubChem CID 138714421) has the molecular formula C25H20O6 and a molecular weight of 416.43 g/mol. Its IUPAC name is [2-(2-acetyloxy-1,3-dioxo-5,6-dihydroinden-2-yl)-5-phenylphenyl] acetate.
| Compound Name | [2-(2-acetyloxy-1,3-dioxo-5,6-dihydroinden-2-yl)-5-phenylphenyl] acetate |
|---|---|
| PubChem CID | 138714421 |
| Molecular Formula | C25H20O6 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | [2-(2-acetyloxy-1,3-dioxo-5,6-dihydroinden-2-yl)-5-phenylphenyl] acetate |
| SMILES | CC(=O)Oc1cc(-c2ccccc2)ccc1C1(OC(C)=O)C(=O)C2=CCCC=C2C1=O |
| InChI | InChI=1S/C25H20O6/c1-15(26)30-22-14-18(17-8-4-3-5-9-17)12-13-21(22)25(31-16(2)27)23(28)19-10-6-7-11-20(19)24(25)29/h3-5,8-14H,6-7H2,1-2H3 |
| InChIKey | BYNBPFJKALUMQR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|