C23H26N4O4 — CID 138715982
2-[[4-[(3E)-3-[(Z)-2-(cyclopropylamino)ethenyl]hexa-3,5-dien-1-ynyl]benzoyl]-methylamino]-N-hydroxy-N'-methylpropanediamide (PubChem CID 138715982) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is 2-[[4-[(3E)-3-[(Z)-2-(cyclopropylamino)ethenyl]hexa-3,5-dien-1-ynyl]benzoyl]-methylamino]-N-hydroxy-N'-methylpropanediamide.
| Compound Name | 2-[[4-[(3E)-3-[(Z)-2-(cyclopropylamino)ethenyl]hexa-3,5-dien-1-ynyl]benzoyl]-methylamino]-N-hydroxy-N'-methylpropanediamide |
|---|---|
| PubChem CID | 138715982 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 2-[[4-[(3E)-3-[(Z)-2-(cyclopropylamino)ethenyl]hexa-3,5-dien-1-ynyl]benzoyl]-methylamino]-N-hydroxy-N'-methylpropanediamide |
| SMILES | C=C/C=C(C#Cc1ccc(C(=O)N(C)C(C(=O)NC)C(=O)NO)cc1)\C=C/NC1CC1 |
| InChI | InChI=1S/C23H26N4O4/c1-4-5-16(14-15-25-19-12-13-19)6-7-17-8-10-18(11-9-17)23(30)27(3)20(21(28)24-2)22(29)26-31/h4-5,8-11,14-15,19-20,25,31H,1,12-13H2,2-3H3,(H,24,28)(H,26,29)/b15-14-,16-5- |
| InChIKey | ZRVBBOXAAREVLS-SGXXXJNJSA-N |
| XLogP | 1.11 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|