C28H32N4O5 — CID 89413088
2-[[4-[2-[4-[(3-cyclobutyloxyazetidin-1-yl)methyl]phenyl]ethynyl]benzoyl]-methylamino]-N-hydroxy-N'-methylpropanediamide (PubChem CID 89413088) has the molecular formula C28H32N4O5 and a molecular weight of 504.59 g/mol. Its IUPAC name is 2-[[4-[2-[4-[(3-cyclobutyloxyazetidin-1-yl)methyl]phenyl]ethynyl]benzoyl]-methylamino]-N-hydroxy-N'-methylpropanediamide.
| Compound Name | 2-[[4-[2-[4-[(3-cyclobutyloxyazetidin-1-yl)methyl]phenyl]ethynyl]benzoyl]-methylamino]-N-hydroxy-N'-methylpropanediamide |
|---|---|
| PubChem CID | 89413088 |
| Molecular Formula | C28H32N4O5 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | 2-[[4-[2-[4-[(3-cyclobutyloxyazetidin-1-yl)methyl]phenyl]ethynyl]benzoyl]-methylamino]-N-hydroxy-N'-methylpropanediamide |
| SMILES | CNC(=O)C(C(=O)NO)N(C)C(=O)c1ccc(C#Cc2ccc(CN3CC(OC4CCC4)C3)cc2)cc1 |
| InChI | InChI=1S/C28H32N4O5/c1-29-26(33)25(27(34)30-36)31(2)28(35)22-14-12-20(13-15-22)7-6-19-8-10-21(11-9-19)16-32-17-24(18-32)37-23-4-3-5-23/h8-15,23-25,36H,3-5,16-18H2,1-2H3,(H,29,33)(H,30,34) |
| InChIKey | PJKFBYBIBMXQKC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|