C27H30FN3O5 — CID 153098931
4-[2-[4-[(3-ethoxyazetidin-1-yl)methyl]phenyl]ethynyl]-3-fluoro-N-[4-hydroxy-1-(methylamino)-1,3-dioxobutan-2-yl]-N-methylbenzamide (PubChem CID 153098931) has the molecular formula C27H30FN3O5 and a molecular weight of 495.55 g/mol. Its IUPAC name is 4-[2-[4-[(3-ethoxyazetidin-1-yl)methyl]phenyl]ethynyl]-3-fluoro-N-[4-hydroxy-1-(methylamino)-1,3-dioxobutan-2-yl]-N-methylbenzamide.
| Compound Name | 4-[2-[4-[(3-ethoxyazetidin-1-yl)methyl]phenyl]ethynyl]-3-fluoro-N-[4-hydroxy-1-(methylamino)-1,3-dioxobutan-2-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 153098931 |
| Molecular Formula | C27H30FN3O5 |
| Molecular Weight | 495.55 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | 4-[2-[4-[(3-ethoxyazetidin-1-yl)methyl]phenyl]ethynyl]-3-fluoro-N-[4-hydroxy-1-(methylamino)-1,3-dioxobutan-2-yl]-N-methylbenzamide |
| SMILES | CCOC1CN(Cc2ccc(C#Cc3ccc(C(=O)N(C)C(C(=O)CO)C(=O)NC)cc3F)cc2)C1 |
| InChI | InChI=1S/C27H30FN3O5/c1-4-36-22-15-31(16-22)14-19-7-5-18(6-8-19)9-10-20-11-12-21(13-23(20)28)27(35)30(3)25(24(33)17-32)26(34)29-2/h5-8,11-13,22,25,32H,4,14-17H2,1-3H3,(H,29,34) |
| InChIKey | VQRJWGJNAKBSNX-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.55 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|