C26H28N4O5 — CID 161408099
N-[4-hydroxy-1-(methylamino)-1,3-dioxobutan-2-yl]-N-methyl-4-[2-[4-[(3-oxopiperazin-1-yl)methyl]phenyl]ethynyl]benzamide (PubChem CID 161408099) has the molecular formula C26H28N4O5 and a molecular weight of 476.53 g/mol. Its IUPAC name is N-[4-hydroxy-1-(methylamino)-1,3-dioxobutan-2-yl]-N-methyl-4-[2-[4-[(3-oxopiperazin-1-yl)methyl]phenyl]ethynyl]benzamide.
| Compound Name | N-[4-hydroxy-1-(methylamino)-1,3-dioxobutan-2-yl]-N-methyl-4-[2-[4-[(3-oxopiperazin-1-yl)methyl]phenyl]ethynyl]benzamide |
|---|---|
| PubChem CID | 161408099 |
| Molecular Formula | C26H28N4O5 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | N-[4-hydroxy-1-(methylamino)-1,3-dioxobutan-2-yl]-N-methyl-4-[2-[4-[(3-oxopiperazin-1-yl)methyl]phenyl]ethynyl]benzamide |
| SMILES | CNC(=O)C(C(=O)CO)N(C)C(=O)c1ccc(C#Cc2ccc(CN3CCNC(=O)C3)cc2)cc1 |
| InChI | InChI=1S/C26H28N4O5/c1-27-25(34)24(22(32)17-31)29(2)26(35)21-11-9-19(10-12-21)4-3-18-5-7-20(8-6-18)15-30-14-13-28-23(33)16-30/h5-12,24,31H,13-17H2,1-2H3,(H,27,34)(H,28,33) |
| InChIKey | VVCQNKMNRZJXJV-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|