C22H26N2O5 — CID 157373344
N-[4-hydroxy-1-(methylamino)-1,3-dioxobutan-2-yl]-4-[4-(3-hydroxypropyl)phenyl]-N-methylbenzamide (PubChem CID 157373344) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is N-[4-hydroxy-1-(methylamino)-1,3-dioxobutan-2-yl]-4-[4-(3-hydroxypropyl)phenyl]-N-methylbenzamide.
| Compound Name | N-[4-hydroxy-1-(methylamino)-1,3-dioxobutan-2-yl]-4-[4-(3-hydroxypropyl)phenyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 157373344 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | N-[4-hydroxy-1-(methylamino)-1,3-dioxobutan-2-yl]-4-[4-(3-hydroxypropyl)phenyl]-N-methylbenzamide |
| SMILES | CNC(=O)C(C(=O)CO)N(C)C(=O)c1ccc(-c2ccc(CCCO)cc2)cc1 |
| InChI | InChI=1S/C22H26N2O5/c1-23-21(28)20(19(27)14-26)24(2)22(29)18-11-9-17(10-12-18)16-7-5-15(6-8-16)4-3-13-25/h5-12,20,25-26H,3-4,13-14H2,1-2H3,(H,23,28) |
| InChIKey | BKAGXUOJTPDXSQ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|