C19H18F3N3O4 — CID 157497346
N-[4-hydroxy-1-(methylamino)-1,3-dioxobutan-2-yl]-N-methyl-4-[5-(trifluoromethyl)-3-pyridinyl]benzamide (PubChem CID 157497346) has the molecular formula C19H18F3N3O4 and a molecular weight of 409.36 g/mol. Its IUPAC name is N-[4-hydroxy-1-(methylamino)-1,3-dioxobutan-2-yl]-N-methyl-4-[5-(trifluoromethyl)-3-pyridinyl]benzamide.
| Compound Name | N-[4-hydroxy-1-(methylamino)-1,3-dioxobutan-2-yl]-N-methyl-4-[5-(trifluoromethyl)-3-pyridinyl]benzamide |
|---|---|
| PubChem CID | 157497346 |
| Molecular Formula | C19H18F3N3O4 |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | N-[4-hydroxy-1-(methylamino)-1,3-dioxobutan-2-yl]-N-methyl-4-[5-(trifluoromethyl)-3-pyridinyl]benzamide |
| SMILES | CNC(=O)C(C(=O)CO)N(C)C(=O)c1ccc(-c2cncc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C19H18F3N3O4/c1-23-17(28)16(15(27)10-26)25(2)18(29)12-5-3-11(4-6-12)13-7-14(9-24-8-13)19(20,21)22/h3-9,16,26H,10H2,1-2H3,(H,23,28) |
| InChIKey | BXZKSLGOSKAZCM-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|