C25H28N4O5 — CID 147307399
N-[4-hydroxy-1-(methylamino)-1,3-dioxobutan-2-yl]-4-[4-(3-imidazol-1-ylpropoxy)phenyl]-N-methylbenzamide (PubChem CID 147307399) has the molecular formula C25H28N4O5 and a molecular weight of 464.52 g/mol. Its IUPAC name is N-[4-hydroxy-1-(methylamino)-1,3-dioxobutan-2-yl]-4-[4-(3-imidazol-1-ylpropoxy)phenyl]-N-methylbenzamide.
| Compound Name | N-[4-hydroxy-1-(methylamino)-1,3-dioxobutan-2-yl]-4-[4-(3-imidazol-1-ylpropoxy)phenyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 147307399 |
| Molecular Formula | C25H28N4O5 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | N-[4-hydroxy-1-(methylamino)-1,3-dioxobutan-2-yl]-4-[4-(3-imidazol-1-ylpropoxy)phenyl]-N-methylbenzamide |
| SMILES | CNC(=O)C(C(=O)CO)N(C)C(=O)c1ccc(-c2ccc(OCCCn3ccnc3)cc2)cc1 |
| InChI | InChI=1S/C25H28N4O5/c1-26-24(32)23(22(31)16-30)28(2)25(33)20-6-4-18(5-7-20)19-8-10-21(11-9-19)34-15-3-13-29-14-12-27-17-29/h4-12,14,17,23,30H,3,13,15-16H2,1-2H3,(H,26,32) |
| InChIKey | CXGXRQHNGJSBMG-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|