C24H31N3O8 — CID 89447883
N-hydroxy-2-[[4-[4-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]phenyl]benzoyl]-methylamino]-N'-methylpropanediamide (PubChem CID 89447883) has the molecular formula C24H31N3O8 and a molecular weight of 489.53 g/mol. Its IUPAC name is N-hydroxy-2-[[4-[4-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]phenyl]benzoyl]-methylamino]-N'-methylpropanediamide.
| Compound Name | N-hydroxy-2-[[4-[4-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]phenyl]benzoyl]-methylamino]-N'-methylpropanediamide |
|---|---|
| PubChem CID | 89447883 |
| Molecular Formula | C24H31N3O8 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | N-hydroxy-2-[[4-[4-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]phenyl]benzoyl]-methylamino]-N'-methylpropanediamide |
| SMILES | CNC(=O)C(C(=O)NO)N(C)C(=O)c1ccc(-c2ccc(OCCOCCOCCO)cc2)cc1 |
| InChI | InChI=1S/C24H31N3O8/c1-25-22(29)21(23(30)26-32)27(2)24(31)19-5-3-17(4-6-19)18-7-9-20(10-8-18)35-16-15-34-14-13-33-12-11-28/h3-10,21,28,32H,11-16H2,1-2H3,(H,25,29)(H,26,30) |
| InChIKey | VOEWKTXTGZFAQP-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 146.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|