C33H46F3N3S2 — CID 138718093
(Z)-1,1,1-trifluoro-4-imino-4-[4-(2,3,6-trihexylthieno[3,2-b]thiophen-5-yl)-2-pyridinyl]but-2-en-2-amine (PubChem CID 138718093) has the molecular formula C33H46F3N3S2 and a molecular weight of 605.88 g/mol. Its IUPAC name is (Z)-1,1,1-trifluoro-4-imino-4-[4-(2,3,6-trihexylthieno[3,2-b]thiophen-5-yl)-2-pyridinyl]but-2-en-2-amine.
| Compound Name | (Z)-1,1,1-trifluoro-4-imino-4-[4-(2,3,6-trihexylthieno[3,2-b]thiophen-5-yl)-2-pyridinyl]but-2-en-2-amine |
|---|---|
| PubChem CID | 138718093 |
| Molecular Formula | C33H46F3N3S2 |
| Molecular Weight | 605.88 g/mol |
| Exact Mass | 605.31 |
| IUPAC Name | (Z)-1,1,1-trifluoro-4-imino-4-[4-(2,3,6-trihexylthieno[3,2-b]thiophen-5-yl)-2-pyridinyl]but-2-en-2-amine |
| SMILES | [H]/N=C(\C=C(/N)C(F)(F)F)c1cc(-c2sc3c(CCCCCC)c(CCCCCC)sc3c2CCCCCC)ccn1 |
| InChI | InChI=1S/C33H46F3N3S2/c1-4-7-10-13-16-24-28(18-15-12-9-6-3)40-32-25(17-14-11-8-5-2)30(41-31(24)32)23-19-20-39-27(21-23)26(37)22-29(38)33(34,35)36/h19-22,37H,4-18,38H2,1-3H3/b29-22-,37-26+ |
| InChIKey | GQLFKRGXGFQTJE-FPUSOEOPSA-N |
| XLogP | 11.17 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.88 |
| LogP ≤ 5 | 11.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|