C13H20F2O — CID 138718400
2,3-difluoro-4-(4-methylcyclohexen-1-yl)cyclohexan-1-ol (PubChem CID 138718400) has the molecular formula C13H20F2O and a molecular weight of 230.30 g/mol. Its IUPAC name is 2,3-difluoro-4-(4-methylcyclohexen-1-yl)cyclohexan-1-ol.
| Compound Name | 2,3-difluoro-4-(4-methylcyclohexen-1-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 138718400 |
| Molecular Formula | C13H20F2O |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 2,3-difluoro-4-(4-methylcyclohexen-1-yl)cyclohexan-1-ol |
| SMILES | CC1CC=C(C2CCC(O)C(F)C2F)CC1 |
| InChI | InChI=1S/C13H20F2O/c1-8-2-4-9(5-3-8)10-6-7-11(16)13(15)12(10)14/h4,8,10-13,16H,2-3,5-7H2,1H3 |
| InChIKey | AJJQQXYBBCWXIL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|