C18H27NO4S — CID 138720564
methyl (2S,4R)-4-benzylsulfanyl-1-[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]pyrrolidine-2-carboxylate (PubChem CID 138720564) has the molecular formula C18H27NO4S and a molecular weight of 353.48 g/mol. Its IUPAC name is methyl (2S,4R)-4-benzylsulfanyl-1-[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4R)-4-benzylsulfanyl-1-[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 138720564 |
| Molecular Formula | C18H27NO4S |
| Molecular Weight | 353.48 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | methyl (2S,4R)-4-benzylsulfanyl-1-[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H](SCc2ccccc2)CN1C(O)OC(C)(C)C |
| InChI | InChI=1S/C18H27NO4S/c1-18(2,3)23-17(21)19-11-14(10-15(19)16(20)22-4)24-12-13-8-6-5-7-9-13/h5-9,14-15,17,21H,10-12H2,1-4H3/t14-,15+,17?/m1/s1 |
| InChIKey | FYQBYGIOOMCVKK-CKDQBVIESA-N |
| XLogP | 2.63 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.48 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|