About S-sulfanyl 4-propanoylbicyclo[2.2.2]octane-1-carbothioate
S-sulfanyl 4-propanoylbicyclo[2.2.2]octane-1-carbothioate (PubChem CID 138721490) has the molecular formula C12H18O2S2
and a molecular weight of 258.41 g/mol. Its IUPAC name is S-sulfanyl 4-propanoylbicyclo[2.2.2]octane-1-carbothioate.
Molecular Properties
| Compound Name | S-sulfanyl 4-propanoylbicyclo[2.2.2]octane-1-carbothioate |
| PubChem CID | 138721490 |
| Molecular Formula | C12H18O2S2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | S-sulfanyl 4-propanoylbicyclo[2.2.2]octane-1-carbothioate |
| SMILES | CCC(=O)C12CCC(C(=O)SS)(CC1)CC2 |
| InChI | InChI=1S/C12H18O2S2/c1-2-9(13)11-3-6-12(7-4-11,8-5-11)10(14)16-15/h15H,2-8H2,1H3 |
| InChIKey | RLPVDZOYZHPVQH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 34.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze S-sulfanyl 4-propanoylbicyclo[2.2.2]octane-1-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-sulfanyl 4-propanoylbicyclo[2.2.2]octane-1-carbothioate?
The IUPAC name of S-sulfanyl 4-propanoylbicyclo[2.2.2]octane-1-carbothioate (CID 138721490) is S-sulfanyl 4-propanoylbicyclo[2.2.2]octane-1-carbothioate.
What is the SMILES notation for S-sulfanyl 4-propanoylbicyclo[2.2.2]octane-1-carbothioate?
The canonical SMILES for S-sulfanyl 4-propanoylbicyclo[2.2.2]octane-1-carbothioate is CCC(=O)C12CCC(C(=O)SS)(CC1)CC2.
What is the InChIKey of S-sulfanyl 4-propanoylbicyclo[2.2.2]octane-1-carbothioate?
The InChIKey is RLPVDZOYZHPVQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O2S2/c1-2-9(13)11-3-6-12(7-4-11,8-5-11)10(14)16-15/h15H,2-8H2,1H3.
What are the key properties of S-sulfanyl 4-propanoylbicyclo[2.2.2]octane-1-carbothioate?
S-sulfanyl 4-propanoylbicyclo[2.2.2]octane-1-carbothioate has a molecular weight of 258.41 g/mol, XLogP of 3.41, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-sulfanyl 4-propanoylbicyclo[2.2.2]octane-1-carbothioate is sourced from PubChem (CID 138721490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).