C24H27N7OS2 — CID 138721536
2-N-(2-methoxy-4-piperazin-1-ylphenyl)-4-N-[2-(methylsulfanylamino)phenyl]thieno[3,2-d]pyrimidine-2,4-diamine (PubChem CID 138721536) has the molecular formula C24H27N7OS2 and a molecular weight of 493.66 g/mol. Its IUPAC name is 2-N-(2-methoxy-4-piperazin-1-ylphenyl)-4-N-[2-(methylsulfanylamino)phenyl]thieno[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 2-N-(2-methoxy-4-piperazin-1-ylphenyl)-4-N-[2-(methylsulfanylamino)phenyl]thieno[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 138721536 |
| Molecular Formula | C24H27N7OS2 |
| Molecular Weight | 493.66 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | 2-N-(2-methoxy-4-piperazin-1-ylphenyl)-4-N-[2-(methylsulfanylamino)phenyl]thieno[3,2-d]pyrimidine-2,4-diamine |
| SMILES | COc1cc(N2CCNCC2)ccc1Nc1nc(Nc2ccccc2NSC)c2sccc2n1 |
| InChI | InChI=1S/C24H27N7OS2/c1-32-21-15-16(31-12-10-25-11-13-31)7-8-19(21)27-24-28-20-9-14-34-22(20)23(29-24)26-17-5-3-4-6-18(17)30-33-2/h3-9,14-15,25,30H,10-13H2,1-2H3,(H2,26,27,28,29) |
| InChIKey | IGQCUSJLKPMBPU-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.66 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|