C14H17IO2 — CID 138721644
1-[3-(2-iodopropanoyl)phenyl]-2,2-dimethylpropan-1-one (PubChem CID 138721644) has the molecular formula C14H17IO2 and a molecular weight of 344.19 g/mol. Its IUPAC name is 1-[3-(2-iodopropanoyl)phenyl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[3-(2-iodopropanoyl)phenyl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 138721644 |
| Molecular Formula | C14H17IO2 |
| Molecular Weight | 344.19 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | 1-[3-(2-iodopropanoyl)phenyl]-2,2-dimethylpropan-1-one |
| SMILES | CC(I)C(=O)c1cccc(C(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C14H17IO2/c1-9(15)12(16)10-6-5-7-11(8-10)13(17)14(2,3)4/h5-9H,1-4H3 |
| InChIKey | ZZSBGLIVBIIAFA-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.19 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|