C13H21N4O+ — CID 157122902
[amino-[3-(2,2-dimethylpropanoyl)phenyl]methylidene]-[amino(methyl)amino]azanium (PubChem CID 157122902) has the molecular formula C13H21N4O+ and a molecular weight of 249.34 g/mol. Its IUPAC name is [amino-[3-(2,2-dimethylpropanoyl)phenyl]methylidene]-[amino(methyl)amino]azanium.
| Compound Name | [amino-[3-(2,2-dimethylpropanoyl)phenyl]methylidene]-[amino(methyl)amino]azanium |
|---|---|
| PubChem CID | 157122902 |
| Molecular Formula | C13H21N4O+ |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | [amino-[3-(2,2-dimethylpropanoyl)phenyl]methylidene]-[amino(methyl)amino]azanium |
| SMILES | CN(N)[NH+]=C(N)c1cccc(C(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C13H20N4O/c1-13(2,3)11(18)9-6-5-7-10(8-9)12(14)16-17(4)15/h5-8H,15H2,1-4H3,(H2,14,16)/p+1 |
| InChIKey | AIEKMXAEECOVGY-UHFFFAOYSA-O |
| XLogP | -0.58 |
| TPSA | 86.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|