About (2R)-2-(2,5-difluorophenyl)-N-(piperidin-4-ylmethyl)cyclopropan-1-amine
(2R)-2-(2,5-difluorophenyl)-N-(piperidin-4-ylmethyl)cyclopropan-1-amine (PubChem CID 138723133) has the molecular formula C15H20F2N2
and a molecular weight of 266.33 g/mol. Its IUPAC name is (2R)-2-(2,5-difluorophenyl)-N-(piperidin-4-ylmethyl)cyclopropan-1-amine.
Molecular Properties
| Compound Name | (2R)-2-(2,5-difluorophenyl)-N-(piperidin-4-ylmethyl)cyclopropan-1-amine |
| PubChem CID | 138723133 |
| Molecular Formula | C15H20F2N2 |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | (2R)-2-(2,5-difluorophenyl)-N-(piperidin-4-ylmethyl)cyclopropan-1-amine |
| SMILES | Fc1ccc(F)c([C@H]2CC2NCC2CCNCC2)c1 |
| InChI | InChI=1S/C15H20F2N2/c16-11-1-2-14(17)12(7-11)13-8-15(13)19-9-10-3-5-18-6-4-10/h1-2,7,10,13,15,18-19H,3-6,8-9H2/t13-,15?/m1/s1 |
| InChIKey | ISFWBCQYINRHRW-AFYYWNPRSA-N |
| XLogP | 2.41 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-(2,5-difluorophenyl)-N-(piperidin-4-ylmethyl)cyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(2,5-difluorophenyl)-N-(piperidin-4-ylmethyl)cyclopropan-1-amine?
The IUPAC name of (2R)-2-(2,5-difluorophenyl)-N-(piperidin-4-ylmethyl)cyclopropan-1-amine (CID 138723133) is (2R)-2-(2,5-difluorophenyl)-N-(piperidin-4-ylmethyl)cyclopropan-1-amine.
What is the SMILES notation for (2R)-2-(2,5-difluorophenyl)-N-(piperidin-4-ylmethyl)cyclopropan-1-amine?
The canonical SMILES for (2R)-2-(2,5-difluorophenyl)-N-(piperidin-4-ylmethyl)cyclopropan-1-amine is Fc1ccc(F)c([C@H]2CC2NCC2CCNCC2)c1.
What is the InChIKey of (2R)-2-(2,5-difluorophenyl)-N-(piperidin-4-ylmethyl)cyclopropan-1-amine?
The InChIKey is ISFWBCQYINRHRW-AFYYWNPRSA-N. The full InChI is InChI=1S/C15H20F2N2/c16-11-1-2-14(17)12(7-11)13-8-15(13)19-9-10-3-5-18-6-4-10/h1-2,7,10,13,15,18-19H,3-6,8-9H2/t13-,15?/m1/s1.
What are the key properties of (2R)-2-(2,5-difluorophenyl)-N-(piperidin-4-ylmethyl)cyclopropan-1-amine?
(2R)-2-(2,5-difluorophenyl)-N-(piperidin-4-ylmethyl)cyclopropan-1-amine has a molecular weight of 266.33 g/mol, XLogP of 2.41, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(2,5-difluorophenyl)-N-(piperidin-4-ylmethyl)cyclopropan-1-amine is sourced from PubChem (CID 138723133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).