C11H13F2NS — CID 124680748
(7S)-7-(2,5-difluorophenyl)-1,4-thiazepane (PubChem CID 124680748) has the molecular formula C11H13F2NS and a molecular weight of 229.29 g/mol. Its IUPAC name is (7S)-7-(2,5-difluorophenyl)-1,4-thiazepane.
| Compound Name | (7S)-7-(2,5-difluorophenyl)-1,4-thiazepane |
|---|---|
| PubChem CID | 124680748 |
| Molecular Formula | C11H13F2NS |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | (7S)-7-(2,5-difluorophenyl)-1,4-thiazepane |
| SMILES | Fc1ccc(F)c([C@@H]2CCNCCS2)c1 |
| InChI | InChI=1S/C11H13F2NS/c12-8-1-2-10(13)9(7-8)11-3-4-14-5-6-15-11/h1-2,7,11,14H,3-6H2/t11-/m0/s1 |
| InChIKey | ZBFUUKXYILRKAN-NSHDSACASA-N |
| XLogP | 2.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |