C12H19FOS — CID 138723692
6-(3-fluorocyclohexa-1,5-dien-1-yl)sulfanylhexan-1-ol (PubChem CID 138723692) has the molecular formula C12H19FOS and a molecular weight of 230.35 g/mol. Its IUPAC name is 6-(3-fluorocyclohexa-1,5-dien-1-yl)sulfanylhexan-1-ol.
| Compound Name | 6-(3-fluorocyclohexa-1,5-dien-1-yl)sulfanylhexan-1-ol |
|---|---|
| PubChem CID | 138723692 |
| Molecular Formula | C12H19FOS |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 6-(3-fluorocyclohexa-1,5-dien-1-yl)sulfanylhexan-1-ol |
| SMILES | OCCCCCCSC1=CC(F)CC=C1 |
| InChI | InChI=1S/C12H19FOS/c13-11-6-5-7-12(10-11)15-9-4-2-1-3-8-14/h5,7,10-11,14H,1-4,6,8-9H2 |
| InChIKey | FGCWNCSZPUFVNF-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|