C26H31ClN4O — CID 138724503
[4-[(E)-2-(3-amino-6-chloroisoquinolin-4-yl)ethenyl]phenyl]-(3-piperidin-1-ylpropylamino)methanol (PubChem CID 138724503) has the molecular formula C26H31ClN4O and a molecular weight of 451.01 g/mol. Its IUPAC name is [4-[(E)-2-(3-amino-6-chloroisoquinolin-4-yl)ethenyl]phenyl]-(3-piperidin-1-ylpropylamino)methanol.
| Compound Name | [4-[(E)-2-(3-amino-6-chloroisoquinolin-4-yl)ethenyl]phenyl]-(3-piperidin-1-ylpropylamino)methanol |
|---|---|
| PubChem CID | 138724503 |
| Molecular Formula | C26H31ClN4O |
| Molecular Weight | 451.01 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | [4-[(E)-2-(3-amino-6-chloroisoquinolin-4-yl)ethenyl]phenyl]-(3-piperidin-1-ylpropylamino)methanol |
| SMILES | Nc1ncc2ccc(Cl)cc2c1/C=C/c1ccc(C(O)NCCCN2CCCCC2)cc1 |
| InChI | InChI=1S/C26H31ClN4O/c27-22-11-10-21-18-30-25(28)23(24(21)17-22)12-7-19-5-8-20(9-6-19)26(32)29-13-4-16-31-14-2-1-3-15-31/h5-12,17-18,26,29,32H,1-4,13-16H2,(H2,28,30)/b12-7+ |
| InChIKey | DLTBTUQPHXGXNE-KPKJPENVSA-N |
| XLogP | 5.10 |
| TPSA | 74.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.01 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|