C33H31ClF3N5O — CID 156555988
[4-[2-[2-amino-5-(4-chlorophenyl)-3-pyridinyl]ethynyl]phenyl]-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)anilino]methanol (PubChem CID 156555988) has the molecular formula C33H31ClF3N5O and a molecular weight of 606.09 g/mol. Its IUPAC name is [4-[2-[2-amino-5-(4-chlorophenyl)-3-pyridinyl]ethynyl]phenyl]-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)anilino]methanol.
| Compound Name | [4-[2-[2-amino-5-(4-chlorophenyl)-3-pyridinyl]ethynyl]phenyl]-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)anilino]methanol |
|---|---|
| PubChem CID | 156555988 |
| Molecular Formula | C33H31ClF3N5O |
| Molecular Weight | 606.09 g/mol |
| Exact Mass | 605.22 |
| IUPAC Name | [4-[2-[2-amino-5-(4-chlorophenyl)-3-pyridinyl]ethynyl]phenyl]-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)anilino]methanol |
| SMILES | CN1CCN(Cc2ccc(NC(O)c3ccc(C#Cc4cc(-c5ccc(Cl)cc5)cnc4N)cc3)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C33H31ClF3N5O/c1-41-14-16-42(17-15-41)21-26-10-13-29(19-30(26)33(35,36)37)40-32(43)24-5-2-22(3-6-24)4-7-25-18-27(20-39-31(25)38)23-8-11-28(34)12-9-23/h2-3,5-6,8-13,18-20,32,40,43H,14-17,21H2,1H3,(H2,38,39) |
| InChIKey | NOVOXZLGJIZUIL-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 77.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.09 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|