C30H30ClN5O — CID 134276914
[4-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]phenyl]-[4-[(4-methylpiperazin-1-yl)methyl]anilino]methanol (PubChem CID 134276914) has the molecular formula C30H30ClN5O and a molecular weight of 512.06 g/mol. Its IUPAC name is [4-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]phenyl]-[4-[(4-methylpiperazin-1-yl)methyl]anilino]methanol.
| Compound Name | [4-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]phenyl]-[4-[(4-methylpiperazin-1-yl)methyl]anilino]methanol |
|---|---|
| PubChem CID | 134276914 |
| Molecular Formula | C30H30ClN5O |
| Molecular Weight | 512.06 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | [4-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]phenyl]-[4-[(4-methylpiperazin-1-yl)methyl]anilino]methanol |
| SMILES | CN1CCN(Cc2ccc(NC(O)c3ccc(C#Cc4c(N)ncc5ccc(Cl)cc45)cc3)cc2)CC1 |
| InChI | InChI=1S/C30H30ClN5O/c1-35-14-16-36(17-15-35)20-22-4-11-26(12-5-22)34-30(37)23-7-2-21(3-8-23)6-13-27-28-18-25(31)10-9-24(28)19-33-29(27)32/h2-5,7-12,18-19,30,34,37H,14-17,20H2,1H3,(H2,32,33) |
| InChIKey | GORVGCGQAZSVTJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 77.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.06 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|