C19H22F3N5O2S — CID 138724984
2-[5-[1-(difluoromethyl)pyrazol-4-yl]-6-[2-fluoro-2-(methoxymethyl)-3-prop-2-enoxypropyl]-1,4-dihydropyrimidin-2-yl]-1,3-thiazole (PubChem CID 138724984) has the molecular formula C19H22F3N5O2S and a molecular weight of 441.48 g/mol. Its IUPAC name is 2-[5-[1-(difluoromethyl)pyrazol-4-yl]-6-[2-fluoro-2-(methoxymethyl)-3-prop-2-enoxypropyl]-1,4-dihydropyrimidin-2-yl]-1,3-thiazole.
| Compound Name | 2-[5-[1-(difluoromethyl)pyrazol-4-yl]-6-[2-fluoro-2-(methoxymethyl)-3-prop-2-enoxypropyl]-1,4-dihydropyrimidin-2-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 138724984 |
| Molecular Formula | C19H22F3N5O2S |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | 2-[5-[1-(difluoromethyl)pyrazol-4-yl]-6-[2-fluoro-2-(methoxymethyl)-3-prop-2-enoxypropyl]-1,4-dihydropyrimidin-2-yl]-1,3-thiazole |
| SMILES | C=CCOCC(F)(COC)CC1=C(c2cnn(C(F)F)c2)CN=C(c2nccs2)N1 |
| InChI | InChI=1S/C19H22F3N5O2S/c1-3-5-29-12-19(22,11-28-2)7-15-14(13-8-25-27(10-13)18(20)21)9-24-16(26-15)17-23-4-6-30-17/h3-4,6,8,10,18H,1,5,7,9,11-12H2,2H3,(H,24,26) |
| InChIKey | KZFMCOJGKOIVLS-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|