C14H24ClNO — CID 138725675
(2E,7E)-7-[chloro(ethyl)amino]-4-methyl-6-methylidenedeca-2,7-dien-3-ol (PubChem CID 138725675) has the molecular formula C14H24ClNO and a molecular weight of 257.80 g/mol. Its IUPAC name is (2E,7E)-7-[chloro(ethyl)amino]-4-methyl-6-methylidenedeca-2,7-dien-3-ol.
| Compound Name | (2E,7E)-7-[chloro(ethyl)amino]-4-methyl-6-methylidenedeca-2,7-dien-3-ol |
|---|---|
| PubChem CID | 138725675 |
| Molecular Formula | C14H24ClNO |
| Molecular Weight | 257.80 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | (2E,7E)-7-[chloro(ethyl)amino]-4-methyl-6-methylidenedeca-2,7-dien-3-ol |
| SMILES | C=C(CC(C)/C(O)=C\C)/C(=C\CC)N(Cl)CC |
| InChI | InChI=1S/C14H24ClNO/c1-6-9-13(16(15)8-3)11(4)10-12(5)14(17)7-2/h7,9,12,17H,4,6,8,10H2,1-3,5H3/b13-9+,14-7+ |
| InChIKey | OLGIQLQTDHWQQK-BTLVJFLNSA-N |
| XLogP | 4.80 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.80 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|