C15H23NO — CID 163859776
4-[1-[but-3-enyl(propyl)amino]ethenyl]cyclohexa-1,3-dien-1-ol (PubChem CID 163859776) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is 4-[1-[but-3-enyl(propyl)amino]ethenyl]cyclohexa-1,3-dien-1-ol.
| Compound Name | 4-[1-[but-3-enyl(propyl)amino]ethenyl]cyclohexa-1,3-dien-1-ol |
|---|---|
| PubChem CID | 163859776 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 4-[1-[but-3-enyl(propyl)amino]ethenyl]cyclohexa-1,3-dien-1-ol |
| SMILES | C=CCCN(CCC)C(=C)C1=CC=C(O)CC1 |
| InChI | InChI=1S/C15H23NO/c1-4-6-12-16(11-5-2)13(3)14-7-9-15(17)10-8-14/h4,7,9,17H,1,3,5-6,8,10-12H2,2H3 |
| InChIKey | PBLPTLWRSAODQC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|