C10H17NO — CID 123615765
5,6-di(ethylidene)-1-methylpiperidin-2-ol (PubChem CID 123615765) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is 5,6-di(ethylidene)-1-methylpiperidin-2-ol.
| Compound Name | 5,6-di(ethylidene)-1-methylpiperidin-2-ol |
|---|---|
| PubChem CID | 123615765 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 5,6-di(ethylidene)-1-methylpiperidin-2-ol |
| SMILES | CC=C1CCC(O)N(C)C1=CC |
| InChI | InChI=1S/C10H17NO/c1-4-8-6-7-10(12)11(3)9(8)5-2/h4-5,10,12H,6-7H2,1-3H3 |
| InChIKey | ODFIKFZAWCOTMR-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |