C20H38N2O — CID 143307643
5-[[(2E,4Z,6E)-8-(dimethylamino)-6,7-dimethylocta-2,4,6-trien-3-yl]-propylamino]pentan-1-ol (PubChem CID 143307643) has the molecular formula C20H38N2O and a molecular weight of 322.54 g/mol. Its IUPAC name is 5-[[(2E,4Z,6E)-8-(dimethylamino)-6,7-dimethylocta-2,4,6-trien-3-yl]-propylamino]pentan-1-ol.
| Compound Name | 5-[[(2E,4Z,6E)-8-(dimethylamino)-6,7-dimethylocta-2,4,6-trien-3-yl]-propylamino]pentan-1-ol |
|---|---|
| PubChem CID | 143307643 |
| Molecular Formula | C20H38N2O |
| Molecular Weight | 322.54 g/mol |
| Exact Mass | 322.30 |
| IUPAC Name | 5-[[(2E,4Z,6E)-8-(dimethylamino)-6,7-dimethylocta-2,4,6-trien-3-yl]-propylamino]pentan-1-ol |
| SMILES | C/C=C(\C=C/C(C)=C(\C)CN(C)C)N(CCC)CCCCCO |
| InChI | InChI=1S/C20H38N2O/c1-7-14-22(15-10-9-11-16-23)20(8-2)13-12-18(3)19(4)17-21(5)6/h8,12-13,23H,7,9-11,14-17H2,1-6H3/b13-12-,19-18+,20-8+ |
| InChIKey | FFOPISKVQBCUCX-FLQVMVJFSA-N |
| XLogP | 4.22 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.54 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|