C17H21NO — CID 177390448
5-[bis(cyclopenta-1,2,4-trien-1-ylmethyl)amino]pentan-1-ol (PubChem CID 177390448) has the molecular formula C17H21NO and a molecular weight of 255.36 g/mol. Its IUPAC name is 5-[bis(cyclopenta-1,2,4-trien-1-ylmethyl)amino]pentan-1-ol.
| Compound Name | 5-[bis(cyclopenta-1,2,4-trien-1-ylmethyl)amino]pentan-1-ol |
|---|---|
| PubChem CID | 177390448 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 5-[bis(cyclopenta-1,2,4-trien-1-ylmethyl)amino]pentan-1-ol |
| SMILES | OCCCCCN(CC1=C=CC=C1)CC1=C=CC=C1 |
| InChI | InChI=1S/C17H21NO/c19-13-7-1-6-12-18(14-16-8-2-3-9-16)15-17-10-4-5-11-17/h2-5,8,10,19H,1,6-7,12-15H2 |
| InChIKey | UHLFMZWTDXJATE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|