C21H23N — CID 138725676
(2Z)-2-ethylidene-1-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]-5a,6-dihydrobenzo[cd]indole (PubChem CID 138725676) has the molecular formula C21H23N and a molecular weight of 289.42 g/mol. Its IUPAC name is (2Z)-2-ethylidene-1-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]-5a,6-dihydrobenzo[cd]indole.
| Compound Name | (2Z)-2-ethylidene-1-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]-5a,6-dihydrobenzo[cd]indole |
|---|---|
| PubChem CID | 138725676 |
| Molecular Formula | C21H23N |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | (2Z)-2-ethylidene-1-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]-5a,6-dihydrobenzo[cd]indole |
| SMILES | C=C/C=C(\C=C/C)Cn1c2c3c(/c1=C/C)=CC=CC3CC=C2 |
| InChI | InChI=1S/C21H23N/c1-4-9-16(10-5-2)15-22-19(6-3)18-13-7-11-17-12-8-14-20(22)21(17)18/h4-11,13-14,17H,1,12,15H2,2-3H3/b10-5-,16-9+,19-6- |
| InChIKey | UGHXHOARVQEUFO-HWGVNGLFSA-N |
| XLogP | 3.83 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|