C8H12N2 — CID 138725760
N-ethylidene-N'-[(1Z)-2-methylbuta-1,3-dienyl]methanimidamide (PubChem CID 138725760) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is N-ethylidene-N'-[(1Z)-2-methylbuta-1,3-dienyl]methanimidamide.
| Compound Name | N-ethylidene-N'-[(1Z)-2-methylbuta-1,3-dienyl]methanimidamide |
|---|---|
| PubChem CID | 138725760 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | N-ethylidene-N'-[(1Z)-2-methylbuta-1,3-dienyl]methanimidamide |
| SMILES | C=C/C(C)=C\N=C\N=C\C |
| InChI | InChI=1S/C8H12N2/c1-4-8(3)6-10-7-9-5-2/h4-7H,1H2,2-3H3/b8-6-,9-5+,10-7+ |
| InChIKey | WLXFRIYMVHRYMT-IYIBNSMCSA-N |
| XLogP | 2.20 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|