C10H20N2 — CID 138726876
N,1-di(propan-2-yl)pyrrolidin-2-imine (PubChem CID 138726876) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is N,1-di(propan-2-yl)pyrrolidin-2-imine.
| Compound Name | N,1-di(propan-2-yl)pyrrolidin-2-imine |
|---|---|
| PubChem CID | 138726876 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | N,1-di(propan-2-yl)pyrrolidin-2-imine |
| SMILES | CC(C)/N=C1\CCCN1C(C)C |
| InChI | InChI=1S/C10H20N2/c1-8(2)11-10-6-5-7-12(10)9(3)4/h8-9H,5-7H2,1-4H3/b11-10+ |
| InChIKey | QYVBJXLWFGQSMZ-ZHACJKMWSA-N |
| XLogP | 2.30 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|