C17H35FN2O4 — CID 138727903
N-[2-fluoro-3-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]butyl]-2-methylpropanamide (PubChem CID 138727903) has the molecular formula C17H35FN2O4 and a molecular weight of 350.48 g/mol. Its IUPAC name is N-[2-fluoro-3-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]butyl]-2-methylpropanamide.
| Compound Name | N-[2-fluoro-3-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]butyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 138727903 |
| Molecular Formula | C17H35FN2O4 |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | N-[2-fluoro-3-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]butyl]-2-methylpropanamide |
| SMILES | CC(C)NCCOCCOCCOC(C)C(F)CNC(=O)C(C)C |
| InChI | InChI=1S/C17H35FN2O4/c1-13(2)17(21)20-12-16(18)15(5)24-11-10-23-9-8-22-7-6-19-14(3)4/h13-16,19H,6-12H2,1-5H3,(H,20,21) |
| InChIKey | QDCGUYZETNSGBQ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|