C11H23FN2O2 — CID 138727067
N-[2-fluoro-3-[2-(propan-2-ylamino)ethoxy]butyl]acetamide (PubChem CID 138727067) has the molecular formula C11H23FN2O2 and a molecular weight of 234.31 g/mol. Its IUPAC name is N-[2-fluoro-3-[2-(propan-2-ylamino)ethoxy]butyl]acetamide.
| Compound Name | N-[2-fluoro-3-[2-(propan-2-ylamino)ethoxy]butyl]acetamide |
|---|---|
| PubChem CID | 138727067 |
| Molecular Formula | C11H23FN2O2 |
| Molecular Weight | 234.31 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | N-[2-fluoro-3-[2-(propan-2-ylamino)ethoxy]butyl]acetamide |
| SMILES | CC(=O)NCC(F)C(C)OCCNC(C)C |
| InChI | InChI=1S/C11H23FN2O2/c1-8(2)13-5-6-16-9(3)11(12)7-14-10(4)15/h8-9,11,13H,5-7H2,1-4H3,(H,14,15) |
| InChIKey | KPIBUTCFFMVALV-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.31 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|