C19H35NS — CID 138728343
5,8-dimethyl-2,5-di(propan-2-yl)-4,4a,6,7,8,9,10,10a-octahydro-3H-cycloocta[c]pyridine-1-thione (PubChem CID 138728343) has the molecular formula C19H35NS and a molecular weight of 309.56 g/mol. Its IUPAC name is 5,8-dimethyl-2,5-di(propan-2-yl)-4,4a,6,7,8,9,10,10a-octahydro-3H-cycloocta[c]pyridine-1-thione.
| Compound Name | 5,8-dimethyl-2,5-di(propan-2-yl)-4,4a,6,7,8,9,10,10a-octahydro-3H-cycloocta[c]pyridine-1-thione |
|---|---|
| PubChem CID | 138728343 |
| Molecular Formula | C19H35NS |
| Molecular Weight | 309.56 g/mol |
| Exact Mass | 309.25 |
| IUPAC Name | 5,8-dimethyl-2,5-di(propan-2-yl)-4,4a,6,7,8,9,10,10a-octahydro-3H-cycloocta[c]pyridine-1-thione |
| SMILES | CC1CCC2C(=S)N(C(C)C)CCC2C(C)(C(C)C)CC1 |
| InChI | InChI=1S/C19H35NS/c1-13(2)19(6)11-9-15(5)7-8-16-17(19)10-12-20(14(3)4)18(16)21/h13-17H,7-12H2,1-6H3 |
| InChIKey | LGTHDHBHXSNSNJ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.56 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|