C10H17Cl2N — CID 127000189
7,7-dichloro-6-methyl-3-propan-2-yl-3-azabicyclo[4.1.0]heptane (PubChem CID 127000189) has the molecular formula C10H17Cl2N and a molecular weight of 222.16 g/mol. Its IUPAC name is 7,7-dichloro-6-methyl-3-propan-2-yl-3-azabicyclo[4.1.0]heptane.
| Compound Name | 7,7-dichloro-6-methyl-3-propan-2-yl-3-azabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 127000189 |
| Molecular Formula | C10H17Cl2N |
| Molecular Weight | 222.16 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 7,7-dichloro-6-methyl-3-propan-2-yl-3-azabicyclo[4.1.0]heptane |
| SMILES | CC(C)N1CCC2(C)C(C1)C2(Cl)Cl |
| InChI | InChI=1S/C10H17Cl2N/c1-7(2)13-5-4-9(3)8(6-13)10(9,11)12/h7-8H,4-6H2,1-3H3 |
| InChIKey | ASONXAJWJLYRLJ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.16 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|