C23H20N4O4S2 — CID 138732556
[1-[4-(4-carbamoyl-1H-benzimidazol-2-yl)phenyl]-3-(pyridin-2-yldisulfanyl)propan-2-yl] hydrogen carbonate (PubChem CID 138732556) has the molecular formula C23H20N4O4S2 and a molecular weight of 480.57 g/mol. Its IUPAC name is [1-[4-(4-carbamoyl-1H-benzimidazol-2-yl)phenyl]-3-(pyridin-2-yldisulfanyl)propan-2-yl] hydrogen carbonate.
| Compound Name | [1-[4-(4-carbamoyl-1H-benzimidazol-2-yl)phenyl]-3-(pyridin-2-yldisulfanyl)propan-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 138732556 |
| Molecular Formula | C23H20N4O4S2 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | [1-[4-(4-carbamoyl-1H-benzimidazol-2-yl)phenyl]-3-(pyridin-2-yldisulfanyl)propan-2-yl] hydrogen carbonate |
| SMILES | NC(=O)c1cccc2[nH]c(-c3ccc(CC(CSSc4ccccn4)OC(=O)O)cc3)nc12 |
| InChI | InChI=1S/C23H20N4O4S2/c24-21(28)17-4-3-5-18-20(17)27-22(26-18)15-9-7-14(8-10-15)12-16(31-23(29)30)13-32-33-19-6-1-2-11-25-19/h1-11,16H,12-13H2,(H2,24,28)(H,26,27)(H,29,30) |
| InChIKey | QMTCXDNRICFGJA-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 131.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|