C18H24ClN3O5 — CID 138733170
tert-butyl N-[1-(3-carbamoyl-4-chlorophenyl)-2-(cyclopropylcarbamoyloxy)ethyl]carbamate (PubChem CID 138733170) has the molecular formula C18H24ClN3O5 and a molecular weight of 397.86 g/mol. Its IUPAC name is tert-butyl N-[1-(3-carbamoyl-4-chlorophenyl)-2-(cyclopropylcarbamoyloxy)ethyl]carbamate.
| Compound Name | tert-butyl N-[1-(3-carbamoyl-4-chlorophenyl)-2-(cyclopropylcarbamoyloxy)ethyl]carbamate |
|---|---|
| PubChem CID | 138733170 |
| Molecular Formula | C18H24ClN3O5 |
| Molecular Weight | 397.86 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | tert-butyl N-[1-(3-carbamoyl-4-chlorophenyl)-2-(cyclopropylcarbamoyloxy)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(COC(=O)NC1CC1)c1ccc(Cl)c(C(N)=O)c1 |
| InChI | InChI=1S/C18H24ClN3O5/c1-18(2,3)27-17(25)22-14(9-26-16(24)21-11-5-6-11)10-4-7-13(19)12(8-10)15(20)23/h4,7-8,11,14H,5-6,9H2,1-3H3,(H2,20,23)(H,21,24)(H,22,25) |
| InChIKey | GEBXYWVIEOGDDN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.86 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |