C14H18ClN5O3 — CID 175023333
tert-butyl N-[1-[4-chloro-3-(2H-tetrazol-5-yl)phenyl]-2-hydroxyethyl]carbamate (PubChem CID 175023333) has the molecular formula C14H18ClN5O3 and a molecular weight of 339.78 g/mol. Its IUPAC name is tert-butyl N-[1-[4-chloro-3-(2H-tetrazol-5-yl)phenyl]-2-hydroxyethyl]carbamate.
| Compound Name | tert-butyl N-[1-[4-chloro-3-(2H-tetrazol-5-yl)phenyl]-2-hydroxyethyl]carbamate |
|---|---|
| PubChem CID | 175023333 |
| Molecular Formula | C14H18ClN5O3 |
| Molecular Weight | 339.78 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | tert-butyl N-[1-[4-chloro-3-(2H-tetrazol-5-yl)phenyl]-2-hydroxyethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CO)c1ccc(Cl)c(-c2nn[nH]n2)c1 |
| InChI | InChI=1S/C14H18ClN5O3/c1-14(2,3)23-13(22)16-11(7-21)8-4-5-10(15)9(6-8)12-17-19-20-18-12/h4-6,11,21H,7H2,1-3H3,(H,16,22)(H,17,18,19,20) |
| InChIKey | UOBAZFDQMIYWDF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 113.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.78 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |