C14H18ClN5O2 — CID 135255285
tert-butyl N-[(1S)-2-(4-chlorophenyl)-1-(2H-tetrazol-5-yl)ethyl]carbamate (PubChem CID 135255285) has the molecular formula C14H18ClN5O2 and a molecular weight of 323.78 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2-(4-chlorophenyl)-1-(2H-tetrazol-5-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-2-(4-chlorophenyl)-1-(2H-tetrazol-5-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 135255285 |
| Molecular Formula | C14H18ClN5O2 |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | tert-butyl N-[(1S)-2-(4-chlorophenyl)-1-(2H-tetrazol-5-yl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccc(Cl)cc1)c1nn[nH]n1 |
| InChI | InChI=1S/C14H18ClN5O2/c1-14(2,3)22-13(21)16-11(12-17-19-20-18-12)8-9-4-6-10(15)7-5-9/h4-7,11H,8H2,1-3H3,(H,16,21)(H,17,18,19,20)/t11-/m0/s1 |
| InChIKey | BQLPMQNLLSXLEN-NSHDSACASA-N |
| XLogP | 2.66 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |