C16H20ClF2N5O3 — CID 139305617
tert-butyl N-[(1S)-2-aminooxy-1-[4-chloro-3-[2-(difluoromethyl)-1,2,4-triazol-3-yl]phenyl]ethyl]carbamate (PubChem CID 139305617) has the molecular formula C16H20ClF2N5O3 and a molecular weight of 403.82 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2-aminooxy-1-[4-chloro-3-[2-(difluoromethyl)-1,2,4-triazol-3-yl]phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-2-aminooxy-1-[4-chloro-3-[2-(difluoromethyl)-1,2,4-triazol-3-yl]phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 139305617 |
| Molecular Formula | C16H20ClF2N5O3 |
| Molecular Weight | 403.82 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | tert-butyl N-[(1S)-2-aminooxy-1-[4-chloro-3-[2-(difluoromethyl)-1,2,4-triazol-3-yl]phenyl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CON)c1ccc(Cl)c(-c2ncnn2C(F)F)c1 |
| InChI | InChI=1S/C16H20ClF2N5O3/c1-16(2,3)27-15(25)23-12(7-26-20)9-4-5-11(17)10(6-9)13-21-8-22-24(13)14(18)19/h4-6,8,12,14H,7,20H2,1-3H3,(H,23,25)/t12-/m1/s1 |
| InChIKey | JMGZWJKGXMWHTJ-GFCCVEGCSA-N |
| XLogP | 3.45 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.82 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|